About 5-ethenyl-2,3,3,4-tetramethylpyrrole
5-ethenyl-2,3,3,4-tetramethylpyrrole (PubChem CID 147156895) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 5-ethenyl-2,3,3,4-tetramethylpyrrole.
Molecular Properties
| Compound Name | 5-ethenyl-2,3,3,4-tetramethylpyrrole |
| PubChem CID | 147156895 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 5-ethenyl-2,3,3,4-tetramethylpyrrole |
| SMILES | C=CC1=C(C)C(C)(C)C(C)=N1 |
| InChI | InChI=1S/C10H15N/c1-6-9-7(2)10(4,5)8(3)11-9/h6H,1H2,2-5H3 |
| InChIKey | BVBOLWRMHFALJL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-2,3,3,4-tetramethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2,3,3,4-tetramethylpyrrole?
The IUPAC name of 5-ethenyl-2,3,3,4-tetramethylpyrrole (CID 147156895) is 5-ethenyl-2,3,3,4-tetramethylpyrrole.
What is the SMILES notation for 5-ethenyl-2,3,3,4-tetramethylpyrrole?
The canonical SMILES for 5-ethenyl-2,3,3,4-tetramethylpyrrole is C=CC1=C(C)C(C)(C)C(C)=N1.
What is the InChIKey of 5-ethenyl-2,3,3,4-tetramethylpyrrole?
The InChIKey is BVBOLWRMHFALJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-6-9-7(2)10(4,5)8(3)11-9/h6H,1H2,2-5H3.
What are the key properties of 5-ethenyl-2,3,3,4-tetramethylpyrrole?
5-ethenyl-2,3,3,4-tetramethylpyrrole has a molecular weight of 149.24 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2,3,3,4-tetramethylpyrrole is sourced from PubChem (CID 147156895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).