C26H39NO4 — CID 147157174
1-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-ethoxybutan-2-one (PubChem CID 147157174) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is 1-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-ethoxybutan-2-one.
| Compound Name | 1-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-ethoxybutan-2-one |
|---|---|
| PubChem CID | 147157174 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 1-[4-[2-[4-(1,3-benzodioxol-4-yl)piperidin-1-yl]ethyl]cyclohexyl]-4-ethoxybutan-2-one |
| SMILES | CCOCCC(=O)CC1CCC(CCN2CCC(c3cccc4c3OCO4)CC2)CC1 |
| InChI | InChI=1S/C26H39NO4/c1-2-29-17-13-23(28)18-21-8-6-20(7-9-21)10-14-27-15-11-22(12-16-27)24-4-3-5-25-26(24)31-19-30-25/h3-5,20-22H,2,6-19H2,1H3 |
| InChIKey | BVCXJQKUFVBTHY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|