About cyclohexylthiourea
cyclohexylthiourea (PubChem CID 1471603) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is cyclohexylthiourea.
Molecular Properties
| Compound Name | cyclohexylthiourea |
| PubChem CID | 1471603 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | cyclohexylthiourea |
| SMILES | NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C7H14N2S/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
| InChIKey | LEEHHPPLIOFGSC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylthiourea?
The IUPAC name of cyclohexylthiourea (CID 1471603) is cyclohexylthiourea.
What is the SMILES notation for cyclohexylthiourea?
The canonical SMILES for cyclohexylthiourea is NC(=S)NC1CCCCC1.
What is the InChIKey of cyclohexylthiourea?
The InChIKey is LEEHHPPLIOFGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10).
What are the key properties of cyclohexylthiourea?
cyclohexylthiourea has a molecular weight of 158.27 g/mol, XLogP of 1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylthiourea is sourced from PubChem (CID 1471603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).