About 4-phenoxypyrrolo[1,2-a]quinoxaline
4-phenoxypyrrolo[1,2-a]quinoxaline (PubChem CID 1471609) has the molecular formula C17H12N2O
and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-phenoxypyrrolo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 4-phenoxypyrrolo[1,2-a]quinoxaline |
| PubChem CID | 1471609 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-phenoxypyrrolo[1,2-a]quinoxaline |
| SMILES | c1ccc(Oc2nc3ccccc3n3cccc23)cc1 |
| InChI | InChI=1S/C17H12N2O/c1-2-7-13(8-3-1)20-17-16-11-6-12-19(16)15-10-5-4-9-14(15)18-17/h1-12H |
| InChIKey | LLXCMRKISHSDAD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenoxypyrrolo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxypyrrolo[1,2-a]quinoxaline?
The IUPAC name of 4-phenoxypyrrolo[1,2-a]quinoxaline (CID 1471609) is 4-phenoxypyrrolo[1,2-a]quinoxaline.
What is the SMILES notation for 4-phenoxypyrrolo[1,2-a]quinoxaline?
The canonical SMILES for 4-phenoxypyrrolo[1,2-a]quinoxaline is c1ccc(Oc2nc3ccccc3n3cccc23)cc1.
What is the InChIKey of 4-phenoxypyrrolo[1,2-a]quinoxaline?
The InChIKey is LLXCMRKISHSDAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O/c1-2-7-13(8-3-1)20-17-16-11-6-12-19(16)15-10-5-4-9-14(15)18-17/h1-12H.
What are the key properties of 4-phenoxypyrrolo[1,2-a]quinoxaline?
4-phenoxypyrrolo[1,2-a]quinoxaline has a molecular weight of 260.30 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxypyrrolo[1,2-a]quinoxaline is sourced from PubChem (CID 1471609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).