C33H24N8O4 — CID 147161435
5-[[4-(dibenzylamino)-6-[(1,3-dioxoisoindol-5-yl)amino]-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione (PubChem CID 147161435) has the molecular formula C33H24N8O4 and a molecular weight of 596.61 g/mol. Its IUPAC name is 5-[[4-(dibenzylamino)-6-[(1,3-dioxoisoindol-5-yl)amino]-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione.
| Compound Name | 5-[[4-(dibenzylamino)-6-[(1,3-dioxoisoindol-5-yl)amino]-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 147161435 |
| Molecular Formula | C33H24N8O4 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 5-[[4-(dibenzylamino)-6-[(1,3-dioxoisoindol-5-yl)amino]-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Nc3nc(Nc4ccc5c(c4)C(=O)NC5=O)nc(N(Cc4ccccc4)Cc4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C33H24N8O4/c42-27-23-13-11-21(15-25(23)29(44)36-27)34-31-38-32(35-22-12-14-24-26(16-22)30(45)37-28(24)43)40-33(39-31)41(17-19-7-3-1-4-8-19)18-20-9-5-2-6-10-20/h1-16H,17-18H2,(H,36,42,44)(H,37,43,45)(H2,34,35,38,39,40) |
| InChIKey | BVXPNYMRURXUHO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|