C11H9F15O3 — CID 14716147
3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propane-1,2-diol (PubChem CID 14716147) has the molecular formula C11H9F15O3 and a molecular weight of 474.16 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propane-1,2-diol.
| Compound Name | 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 14716147 |
| Molecular Formula | C11H9F15O3 |
| Molecular Weight | 474.16 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propane-1,2-diol |
| SMILES | OCC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F15O3/c12-5(13,3-29-2-4(28)1-27)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)26/h4,27-28H,1-3H2 |
| InChIKey | NSFNNBQPNCVWFZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|