About N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide
N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide (PubChem CID 147161580) has the molecular formula C9H16F3NO2S2
and a molecular weight of 291.36 g/mol. Its IUPAC name is N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 147161580 |
| Molecular Formula | C9H16F3NO2S2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide |
| SMILES | CCOCSSC(C)(C)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S2/c1-4-15-6-16-17-8(2,3)5-13-7(14)9(10,11)12/h4-6H2,1-3H3,(H,13,14) |
| InChIKey | BVYIMFPSGRNZLF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide (CID 147161580) is N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide is CCOCSSC(C)(C)CNC(=O)C(F)(F)F.
What is the InChIKey of N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide?
The InChIKey is BVYIMFPSGRNZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2S2/c1-4-15-6-16-17-8(2,3)5-13-7(14)9(10,11)12/h4-6H2,1-3H3,(H,13,14).
What are the key properties of N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide?
N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide has a molecular weight of 291.36 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(ethoxymethyldisulfanyl)-2-methylpropyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 147161580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).