C11H10ClN5 — CID 147162086
5-(3-chloroanilino)-3-(methylamino)-1H-pyrazole-4-carbonitrile (PubChem CID 147162086) has the molecular formula C11H10ClN5 and a molecular weight of 247.69 g/mol. Its IUPAC name is 5-(3-chloroanilino)-3-(methylamino)-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-(3-chloroanilino)-3-(methylamino)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 147162086 |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-(3-chloroanilino)-3-(methylamino)-1H-pyrazole-4-carbonitrile |
| SMILES | CNc1n[nH]c(Nc2cccc(Cl)c2)c1C#N |
| InChI | InChI=1S/C11H10ClN5/c1-14-10-9(6-13)11(17-16-10)15-8-4-2-3-7(12)5-8/h2-5H,1H3,(H3,14,15,16,17) |
| InChIKey | BWAQGSSDRBNARP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |