C18H30BNO5 — CID 147164810
2-[(3R,5Z,8S)-3-[3-[4-(aminomethyl)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4,7,8-tetrahydrooxaborocin-8-yl]acetic acid (PubChem CID 147164810) has the molecular formula C18H30BNO5 and a molecular weight of 351.25 g/mol. Its IUPAC name is 2-[(3R,5Z,8S)-3-[3-[4-(aminomethyl)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4,7,8-tetrahydrooxaborocin-8-yl]acetic acid.
| Compound Name | 2-[(3R,5Z,8S)-3-[3-[4-(aminomethyl)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4,7,8-tetrahydrooxaborocin-8-yl]acetic acid |
|---|---|
| PubChem CID | 147164810 |
| Molecular Formula | C18H30BNO5 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[(3R,5Z,8S)-3-[3-[4-(aminomethyl)cyclohexyl]-2-oxopropyl]-2-hydroxy-3,4,7,8-tetrahydrooxaborocin-8-yl]acetic acid |
| SMILES | NCC1CCC(CC(=O)C[C@H]2C/C=C\C[C@@H](CC(=O)O)OB2O)CC1 |
| InChI | InChI=1S/C18H30BNO5/c20-12-14-7-5-13(6-8-14)9-16(21)10-15-3-1-2-4-17(11-18(22)23)25-19(15)24/h1-2,13-15,17,24H,3-12,20H2,(H,22,23)/b2-1-/t13?,14?,15-,17+/m1/s1 |
| InChIKey | BWNYXXAFOZOHNF-DTPFJIPKSA-N |
| XLogP | 2.16 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|