C11H12F6O6S2 — CID 147165996
1,1,2,2,3,3-hexafluoro-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxysulfonylpropane-1-sulfonic acid (PubChem CID 147165996) has the molecular formula C11H12F6O6S2 and a molecular weight of 418.33 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxysulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxysulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 147165996 |
| Molecular Formula | C11H12F6O6S2 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxysulfonylpropane-1-sulfonic acid |
| SMILES | C=C(C)/C=C\C(=C/C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H12F6O6S2/c1-4-8(6-5-7(2)3)23-25(21,22)11(16,17)9(12,13)10(14,15)24(18,19)20/h4-6H,2H2,1,3H3,(H,18,19,20)/b6-5-,8-4- |
| InChIKey | BWTXQEOVEKCBAH-QUXRQYFZSA-N |
| XLogP | 3.08 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|