C20H20O2 — CID 147166844
1-(6-hydroxy-2,3,4-trimethylphenyl)-7-methylnaphthalen-2-ol (PubChem CID 147166844) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(6-hydroxy-2,3,4-trimethylphenyl)-7-methylnaphthalen-2-ol.
| Compound Name | 1-(6-hydroxy-2,3,4-trimethylphenyl)-7-methylnaphthalen-2-ol |
|---|---|
| PubChem CID | 147166844 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(6-hydroxy-2,3,4-trimethylphenyl)-7-methylnaphthalen-2-ol |
| SMILES | Cc1ccc2ccc(O)c(-c3c(O)cc(C)c(C)c3C)c2c1 |
| InChI | InChI=1S/C20H20O2/c1-11-5-6-15-7-8-17(21)20(16(15)9-11)19-14(4)13(3)12(2)10-18(19)22/h5-10,21-22H,1-4H3 |
| InChIKey | BWYDKFSZJRKAEM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |