C34H50N2O3 — CID 147167496
(1R,2R,10R,11R,21S)-1,2,6,6,10,18,18-heptamethyl-21-(1,3-oxazolidin-5-yl)-7,13-dioxopentacyclo[12.9.0.02,11.05,10.016,21]tricos-8-ene-8-carbonitrile (PubChem CID 147167496) has the molecular formula C34H50N2O3 and a molecular weight of 534.79 g/mol. Its IUPAC name is (1R,2R,10R,11R,21S)-1,2,6,6,10,18,18-heptamethyl-21-(1,3-oxazolidin-5-yl)-7,13-dioxopentacyclo[12.9.0.02,11.05,10.016,21]tricos-8-ene-8-carbonitrile.
| Compound Name | (1R,2R,10R,11R,21S)-1,2,6,6,10,18,18-heptamethyl-21-(1,3-oxazolidin-5-yl)-7,13-dioxopentacyclo[12.9.0.02,11.05,10.016,21]tricos-8-ene-8-carbonitrile |
|---|---|
| PubChem CID | 147167496 |
| Molecular Formula | C34H50N2O3 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.38 |
| IUPAC Name | (1R,2R,10R,11R,21S)-1,2,6,6,10,18,18-heptamethyl-21-(1,3-oxazolidin-5-yl)-7,13-dioxopentacyclo[12.9.0.02,11.05,10.016,21]tricos-8-ene-8-carbonitrile |
| SMILES | CC1(C)CC[C@]2(C3CNCO3)CC[C@]3(C)C(CC2C1)C(=O)C[C@@H]1[C@@]2(C)C=C(C#N)C(=O)C(C)(C)C2CC[C@]13C |
| InChI | InChI=1S/C34H50N2O3/c1-29(2)10-12-34(27-19-36-20-39-27)13-11-32(6)23(14-22(34)17-29)24(37)15-26-31(5)16-21(18-35)28(38)30(3,4)25(31)8-9-33(26,32)7/h16,22-23,25-27,36H,8-15,17,19-20H2,1-7H3/t22?,23?,25?,26-,27?,31+,32-,33-,34+/m1/s1 |
| InChIKey | BXBLWQWPVMTXEU-KVWQLSJBSA-N |
| XLogP | 6.62 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |