C26H49BN2O3 — CID 147169606
trans-(1S,5R)-N-tert-butyl-1-methyl-2-(piperidin-1-ylmethyl)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 147169606) has the molecular formula C26H49BN2O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is trans-(1S,5R)-N-tert-butyl-1-methyl-2-(piperidin-1-ylmethyl)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,5R)-N-tert-butyl-1-methyl-2-(piperidin-1-ylmethyl)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 147169606 |
| Molecular Formula | C26H49BN2O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.38 |
| IUPAC Name | trans-(1S,5R)-N-tert-butyl-1-methyl-2-(piperidin-1-ylmethyl)-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@]1(C)C[C@H](CCB2OC(C)(C)C(C)(C)O2)CCC1CN1CCCCC1 |
| InChI | InChI=1S/C26H49BN2O3/c1-23(2,3)28-22(30)26(8)18-20(12-13-21(26)19-29-16-10-9-11-17-29)14-15-27-31-24(4,5)25(6,7)32-27/h20-21H,9-19H2,1-8H3,(H,28,30)/t20-,21?,26-/m0/s1 |
| InChIKey | BXLVKVXHFOLKOK-ZYOOMIPPSA-N |
| XLogP | 5.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|