C22H14F8O2 — CID 14717583
2-methyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]phenyl]but-3-yn-2-ol (PubChem CID 14717583) has the molecular formula C22H14F8O2 and a molecular weight of 462.34 g/mol. Its IUPAC name is 2-methyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]phenyl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 14717583 |
| Molecular Formula | C22H14F8O2 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-methyl-4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]phenyl]but-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1c(F)c(F)c(-c2c(F)c(F)c(C#CC(C)(C)O)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C22H14F8O2/c1-21(2,31)7-5-9-13(23)17(27)11(18(28)14(9)24)12-19(29)15(25)10(16(26)20(12)30)6-8-22(3,4)32/h31-32H,1-4H3 |
| InChIKey | YDLUFLVBWLBSJV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|