C34H33N4O2Pt- — CID 147178916
2,4-ditert-butyl-6-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum (PubChem CID 147178916) has the molecular formula C34H33N4O2Pt- and a molecular weight of 724.74 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 147178916 |
| Molecular Formula | C34H33N4O2Pt- |
| Molecular Weight | 724.74 g/mol |
| Exact Mass | 724.23 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3[c-]c(Oc4ccccn4)ccc3)nc(-c3ccccc3)n2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C34H33N4O2.Pt/c1-33(2,3)24-20-26(29(39)27(21-24)34(4,5)6)32-37-30(22-13-8-7-9-14-22)36-31(38-32)23-15-12-16-25(19-23)40-28-17-10-11-18-35-28;/h7-18,20-21,39H,1-6H3;/q-1; |
| InChIKey | BSABZGBUIJGMEU-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.74 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|