About chromene-2,6,7-trione
chromene-2,6,7-trione (PubChem CID 14717987) has the molecular formula C9H4O4
and a molecular weight of 176.13 g/mol. Its IUPAC name is chromene-2,6,7-trione.
Molecular Properties
| Compound Name | chromene-2,6,7-trione |
| PubChem CID | 14717987 |
| Molecular Formula | C9H4O4 |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | chromene-2,6,7-trione |
| SMILES | O=C1C=c2ccc(=O)oc2=CC1=O |
| InChI | InChI=1S/C9H4O4/c10-6-3-5-1-2-9(12)13-8(5)4-7(6)11/h1-4H |
| InChIKey | BDTYTCHUEIBJHC-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze chromene-2,6,7-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromene-2,6,7-trione?
The IUPAC name of chromene-2,6,7-trione (CID 14717987) is chromene-2,6,7-trione.
What is the SMILES notation for chromene-2,6,7-trione?
The canonical SMILES for chromene-2,6,7-trione is O=C1C=c2ccc(=O)oc2=CC1=O.
What is the InChIKey of chromene-2,6,7-trione?
The InChIKey is BDTYTCHUEIBJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4O4/c10-6-3-5-1-2-9(12)13-8(5)4-7(6)11/h1-4H.
What are the key properties of chromene-2,6,7-trione?
chromene-2,6,7-trione has a molecular weight of 176.13 g/mol, XLogP of -1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromene-2,6,7-trione is sourced from PubChem (CID 14717987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).