C23H16ClN3O3 — CID 147179976
6-[7-(2-chlorophenoxy)-2-methylindazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid (PubChem CID 147179976) has the molecular formula C23H16ClN3O3 and a molecular weight of 417.85 g/mol. Its IUPAC name is 6-[7-(2-chlorophenoxy)-2-methylindazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid.
| Compound Name | 6-[7-(2-chlorophenoxy)-2-methylindazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 147179976 |
| Molecular Formula | C23H16ClN3O3 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 6-[7-(2-chlorophenoxy)-2-methylindazol-3-yl]-5H-cyclopenta[b]pyridine-4-carboxylic acid |
| SMILES | Cn1nc2c(Oc3ccccc3Cl)cccc2c1C1=Cc2nccc(C(=O)O)c2C1 |
| InChI | InChI=1S/C23H16ClN3O3/c1-27-22(13-11-16-14(23(28)29)9-10-25-18(16)12-13)15-5-4-8-20(21(15)26-27)30-19-7-3-2-6-17(19)24/h2-10,12H,11H2,1H3,(H,28,29) |
| InChIKey | BZKFAAHWQGZSGX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |