C9H18FN — CID 147180336
(Z,3S,6S,7S)-7-fluoro-6-methyloct-4-en-3-amine (PubChem CID 147180336) has the molecular formula C9H18FN and a molecular weight of 159.25 g/mol. Its IUPAC name is (Z,3S,6S,7S)-7-fluoro-6-methyloct-4-en-3-amine.
| Compound Name | (Z,3S,6S,7S)-7-fluoro-6-methyloct-4-en-3-amine |
|---|---|
| PubChem CID | 147180336 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (Z,3S,6S,7S)-7-fluoro-6-methyloct-4-en-3-amine |
| SMILES | CC[C@H](N)/C=C\[C@H](C)[C@H](C)F |
| InChI | InChI=1S/C9H18FN/c1-4-9(11)6-5-7(2)8(3)10/h5-9H,4,11H2,1-3H3/b6-5-/t7-,8-,9-/m0/s1 |
| InChIKey | BZLZHBHZRYLOQN-XISAPEMPSA-N |
| XLogP | 2.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|