C20H15F3N4O2S2 — CID 147181274
2-(4-methoxyphenyl)-5-[[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-oxadiazole (PubChem CID 147181274) has the molecular formula C20H15F3N4O2S2 and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-[[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-methoxyphenyl)-5-[[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 147181274 |
| Molecular Formula | C20H15F3N4O2S2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-[[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(Sc3nc(C(F)(F)F)nc4sc5c(c34)CCCC5)o2)cc1 |
| InChI | InChI=1S/C20H15F3N4O2S2/c1-28-11-8-6-10(7-9-11)15-26-27-19(29-15)31-17-14-12-4-2-3-5-13(12)30-16(14)24-18(25-17)20(21,22)23/h6-9H,2-5H2,1H3 |
| InChIKey | BZQHOHARXRSLIW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |