C20H32N5O9P — CID 147181966
[1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid (PubChem CID 147181966) has the molecular formula C20H32N5O9P and a molecular weight of 517.48 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 147181966 |
| Molecular Formula | C20H32N5O9P |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-[4-(cyclopentylamino)-6-(methoxymethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-methoxyethyl]phosphonic acid |
| SMILES | COCc1nc(NC2CCCC2)c2cnn([C@@H]3O[C@H](COC(COC)P(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H32N5O9P/c1-31-9-14-23-18(22-11-5-3-4-6-11)12-7-21-25(19(12)24-14)20-17(27)16(26)13(34-20)8-33-15(10-32-2)35(28,29)30/h7,11,13,15-17,20,26-27H,3-6,8-10H2,1-2H3,(H,22,23,24)(H2,28,29,30)/t13-,15?,16-,17-,20-/m1/s1 |
| InChIKey | BZTLUUDUUUVTBK-RFFNOVEHSA-N |
| XLogP | 0.11 |
| TPSA | 190.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|