C20H28BBrO4 — CID 147182672
(1-methylcyclohexyl) 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 147182672) has the molecular formula C20H28BBrO4 and a molecular weight of 423.16 g/mol. Its IUPAC name is (1-methylcyclohexyl) 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | (1-methylcyclohexyl) 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 147182672 |
| Molecular Formula | C20H28BBrO4 |
| Molecular Weight | 423.16 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (1-methylcyclohexyl) 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CC1(OC(=O)c2ccc(Br)cc2B2OC(C)(C)C(C)(C)O2)CCCCC1 |
| InChI | InChI=1S/C20H28BBrO4/c1-18(2)19(3,4)26-21(25-18)16-13-14(22)9-10-15(16)17(23)24-20(5)11-7-6-8-12-20/h9-10,13H,6-8,11-12H2,1-5H3 |
| InChIKey | BZWUALMJXQQFHJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.16 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|