About bis(triethylazanium);sulfite
bis(triethylazanium);sulfite (PubChem CID 14718431) has the molecular formula C12H32N2O3S
and a molecular weight of 284.47 g/mol. Its IUPAC name is bis(triethylazanium);sulfite.
Molecular Properties
| Compound Name | bis(triethylazanium);sulfite |
| PubChem CID | 14718431 |
| Molecular Formula | C12H32N2O3S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | bis(triethylazanium);sulfite |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.O=S([O-])[O-] |
| InChI | InChI=1S/2C6H15N.H2O3S/c2*1-4-7(5-2)6-3;1-4(2)3/h2*4-6H2,1-3H3;(H2,1,2,3) |
| InChIKey | FDCPZJRFIPCMOL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 72.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze bis(triethylazanium);sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(triethylazanium);sulfite?
The IUPAC name of bis(triethylazanium);sulfite (CID 14718431) is bis(triethylazanium);sulfite.
What is the SMILES notation for bis(triethylazanium);sulfite?
The canonical SMILES for bis(triethylazanium);sulfite is CC[NH+](CC)CC.CC[NH+](CC)CC.O=S([O-])[O-].
What is the InChIKey of bis(triethylazanium);sulfite?
The InChIKey is FDCPZJRFIPCMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15N.H2O3S/c2*1-4-7(5-2)6-3;1-4(2)3/h2*4-6H2,1-3H3;(H2,1,2,3).
What are the key properties of bis(triethylazanium);sulfite?
bis(triethylazanium);sulfite has a molecular weight of 284.47 g/mol, XLogP of -1.14, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(triethylazanium);sulfite is sourced from PubChem (CID 14718431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).