About ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate
ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate (PubChem CID 14718694) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate |
| PubChem CID | 14718694 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(CC(OCC)OCC)C(C)(C)C |
| InChI | InChI=1S/C14H28O4/c1-7-16-12(17-8-2)10-11(14(4,5)6)13(15)18-9-3/h11-12H,7-10H2,1-6H3 |
| InChIKey | ZFGZWYURJBMCLR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate?
The IUPAC name of ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate (CID 14718694) is ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate is CCOC(=O)C(CC(OCC)OCC)C(C)(C)C.
What is the InChIKey of ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate?
The InChIKey is ZFGZWYURJBMCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O4/c1-7-16-12(17-8-2)10-11(14(4,5)6)13(15)18-9-3/h11-12H,7-10H2,1-6H3.
What are the key properties of ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate?
ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate has a molecular weight of 260.37 g/mol, XLogP of 3.00, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,2-diethoxyethyl)-3,3-dimethylbutanoate is sourced from PubChem (CID 14718694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).