About 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine
5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine (PubChem CID 147187055) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine.
Molecular Properties
| Compound Name | 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine |
| PubChem CID | 147187055 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine |
| SMILES | Nc1c(C2CCOCC2)ccc2c1CCC2 |
| InChI | InChI=1S/C14H19NO/c15-14-12-3-1-2-10(12)4-5-13(14)11-6-8-16-9-7-11/h4-5,11H,1-3,6-9,15H2 |
| InChIKey | CARQPLOPJBWJMX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine?
The IUPAC name of 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine (CID 147187055) is 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine.
What is the SMILES notation for 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine?
The canonical SMILES for 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine is Nc1c(C2CCOCC2)ccc2c1CCC2.
What is the InChIKey of 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine?
The InChIKey is CARQPLOPJBWJMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c15-14-12-3-1-2-10(12)4-5-13(14)11-6-8-16-9-7-11/h4-5,11H,1-3,6-9,15H2.
What are the key properties of 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine?
5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine has a molecular weight of 217.31 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-4-yl)-2,3-dihydro-1H-inden-4-amine is sourced from PubChem (CID 147187055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).