About methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate
methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate (PubChem CID 14718741) has the molecular formula C12H15F3N2O2
and a molecular weight of 276.26 g/mol. Its IUPAC name is methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate.
Molecular Properties
| Compound Name | methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate |
| PubChem CID | 14718741 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(c1cnc(C(C)(C)C)nc1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-11(2,3)10-16-5-7(6-17-10)8(9(18)19-4)12(13,14)15/h5-6,8H,1-4H3 |
| InChIKey | QIKDUWVQOCGMSN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate?
The IUPAC name of methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate (CID 14718741) is methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate.
What is the SMILES notation for methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate?
The canonical SMILES for methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate is COC(=O)C(c1cnc(C(C)(C)C)nc1)C(F)(F)F.
What is the InChIKey of methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate?
The InChIKey is QIKDUWVQOCGMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O2/c1-11(2,3)10-16-5-7(6-17-10)8(9(18)19-4)12(13,14)15/h5-6,8H,1-4H3.
What are the key properties of methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate?
methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate has a molecular weight of 276.26 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-tert-butylpyrimidin-5-yl)-3,3,3-trifluoropropanoate is sourced from PubChem (CID 14718741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).