C22H26F4N2O2S — CID 14718874
S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanethioate (PubChem CID 14718874) has the molecular formula C22H26F4N2O2S and a molecular weight of 458.52 g/mol. Its IUPAC name is S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanethioate.
| Compound Name | S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanethioate |
|---|---|
| PubChem CID | 14718874 |
| Molecular Formula | C22H26F4N2O2S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | S-[[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl] 2-(2-tert-butylpyrimidin-5-yl)-3,3-dimethylbutanethioate |
| SMILES | CC(C)(C)c1ncc(C(C(=O)SCc2c(F)c(F)c(CO)c(F)c2F)C(C)(C)C)cn1 |
| InChI | InChI=1S/C22H26F4N2O2S/c1-21(2,3)14(11-7-27-20(28-8-11)22(4,5)6)19(30)31-10-13-17(25)15(23)12(9-29)16(24)18(13)26/h7-8,14,29H,9-10H2,1-6H3 |
| InChIKey | XFPBQTKZFXGDEP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|