C55H50OSi — CID 147188972
ditert-butyl-[2-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]dibenzofuran-4-yl]-phenylsilane (PubChem CID 147188972) has the molecular formula C55H50OSi and a molecular weight of 755.09 g/mol. Its IUPAC name is ditert-butyl-[2-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]dibenzofuran-4-yl]-phenylsilane.
| Compound Name | ditert-butyl-[2-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]dibenzofuran-4-yl]-phenylsilane |
|---|---|
| PubChem CID | 147188972 |
| Molecular Formula | C55H50OSi |
| Molecular Weight | 755.09 g/mol |
| Exact Mass | 754.36 |
| IUPAC Name | ditert-butyl-[2-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]dibenzofuran-4-yl]-phenylsilane |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4cc([Si](c5ccccc5)(C(C)(C)C)C(C)(C)C)c5oc6ccccc6c5c4)c4ccccc34)cc21 |
| InChI | InChI=1S/C55H50OSi/c1-53(2,3)57(54(4,5)6,37-20-10-9-11-21-37)49-34-36(32-45-40-23-17-19-29-48(40)56-52(45)49)51-43-26-14-12-24-41(43)50(42-25-13-15-27-44(42)51)35-30-31-39-38-22-16-18-28-46(38)55(7,8)47(39)33-35/h9-34H,1-8H3 |
| InChIKey | CBBHBKOOCINQML-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.09 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|