C24H22F5N3O3 — CID 147189078
1-[1-[(2R)-4,6-difluoro-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]-3-[3-(trifluoromethoxy)phenyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 147189078) has the molecular formula C24H22F5N3O3 and a molecular weight of 495.45 g/mol. Its IUPAC name is 1-[1-[(2R)-4,6-difluoro-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]-3-[3-(trifluoromethoxy)phenyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[1-[(2R)-4,6-difluoro-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]-3-[3-(trifluoromethoxy)phenyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 147189078 |
| Molecular Formula | C24H22F5N3O3 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 1-[1-[(2R)-4,6-difluoro-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]-3-[3-(trifluoromethoxy)phenyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1CCc2c(c(-c3cccc(OC(F)(F)F)c3)nn2C2C3=C(C[C@H]2O)C(F)=CC(F)C3)C1 |
| InChI | InChI=1S/C24H22F5N3O3/c1-12(33)31-6-5-20-18(11-31)22(13-3-2-4-15(7-13)35-24(27,28)29)30-32(20)23-17-8-14(25)9-19(26)16(17)10-21(23)34/h2-4,7,9,14,21,23,34H,5-6,8,10-11H2,1H3/t14?,21-,23?/m1/s1 |
| InChIKey | CBBVFUKOAJHDMU-GPVKKSAQSA-N |
| XLogP | 4.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |