About 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one
4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one (PubChem CID 147196172) has the molecular formula C13H12IN5O
and a molecular weight of 381.18 g/mol. Its IUPAC name is 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one.
Molecular Properties
| Compound Name | 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one |
| PubChem CID | 147196172 |
| Molecular Formula | C13H12IN5O |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one |
| SMILES | Nc1nc(I)nc2c1NC(=O)CN2Cc1ccccc1 |
| InChI | InChI=1S/C13H12IN5O/c14-13-17-11(15)10-12(18-13)19(7-9(20)16-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,16,20)(H2,15,17,18) |
| InChIKey | CCKHTBSJSNKULV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one?
The IUPAC name of 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one (CID 147196172) is 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one.
What is the SMILES notation for 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one?
The canonical SMILES for 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one is Nc1nc(I)nc2c1NC(=O)CN2Cc1ccccc1.
What is the InChIKey of 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one?
The InChIKey is CCKHTBSJSNKULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12IN5O/c14-13-17-11(15)10-12(18-13)19(7-9(20)16-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,16,20)(H2,15,17,18).
What are the key properties of 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one?
4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one has a molecular weight of 381.18 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-8-benzyl-2-iodo-5,7-dihydropteridin-6-one is sourced from PubChem (CID 147196172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).