C35H25F2N2O+ — CID 147196961
2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium (PubChem CID 147196961) has the molecular formula C35H25F2N2O+ and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium.
| Compound Name | 2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 147196961 |
| Molecular Formula | C35H25F2N2O+ |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 2-(7,9-difluoro-3-methyldibenzofuran-2-yl)-1-(2,6-diphenylphenyl)-3-methylimidazol-3-ium |
| SMILES | Cc1cc2oc3cc(F)cc(F)c3c2cc1-c1n(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C35H25F2N2O/c1-22-18-31-29(33-30(37)19-25(36)20-32(33)40-31)21-28(22)35-38(2)16-17-39(35)34-26(23-10-5-3-6-11-23)14-9-15-27(34)24-12-7-4-8-13-24/h3-21H,1-2H3/q+1 |
| InChIKey | KVUBGIRWDIGWLX-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|