C12H8F3N3O3 — CID 1471970
6-acetyl-2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 1471970) has the molecular formula C12H8F3N3O3 and a molecular weight of 299.21 g/mol. Its IUPAC name is 6-acetyl-2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-acetyl-2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 1471970 |
| Molecular Formula | C12H8F3N3O3 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 6-acetyl-2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC(=O)c1nn(-c2cccc(C(F)(F)F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H8F3N3O3/c1-6(19)9-10(20)16-11(21)18(17-9)8-4-2-3-7(5-8)12(13,14)15/h2-5H,1H3,(H,16,20,21) |
| InChIKey | RYBOOAJYQLHVPW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |