C12H23NO2 — CID 147197226
(1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-1-amine (PubChem CID 147197226) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-1-amine.
| Compound Name | (1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-1-amine |
|---|---|
| PubChem CID | 147197226 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-2-en-1-amine |
| SMILES | CCC=C[C@H](N)[C@@H]1OC(C)(C)O[C@@H]1CC |
| InChI | InChI=1S/C12H23NO2/c1-5-7-8-9(13)11-10(6-2)14-12(3,4)15-11/h7-11H,5-6,13H2,1-4H3/t9-,10+,11-/m0/s1 |
| InChIKey | NVWWZXCVCBOXRX-AXFHLTTASA-N |
| XLogP | 2.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|