About (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate (PubChem CID 14719859) has the molecular formula C19H23ClN2O4
and a molecular weight of 378.86 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate.
Molecular Properties
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate |
| PubChem CID | 14719859 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate |
| SMILES | CC1Oc2c(C(=O)OC3CC4CCC(C3)N4C)cc(Cl)cc2N(C)C1=O |
| InChI | InChI=1S/C19H23ClN2O4/c1-10-18(23)22(3)16-7-11(20)6-15(17(16)25-10)19(24)26-14-8-12-4-5-13(9-14)21(12)2/h6-7,10,12-14H,4-5,8-9H2,1-3H3 |
| InChIKey | BXOOFZCPRYVGNL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate?
The IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate (CID 14719859) is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate.
What is the SMILES notation for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate?
The canonical SMILES for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate is CC1Oc2c(C(=O)OC3CC4CCC(C3)N4C)cc(Cl)cc2N(C)C1=O.
What is the InChIKey of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate?
The InChIKey is BXOOFZCPRYVGNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClN2O4/c1-10-18(23)22(3)16-7-11(20)6-15(17(16)25-10)19(24)26-14-8-12-4-5-13(9-14)21(12)2/h6-7,10,12-14H,4-5,8-9H2,1-3H3.
What are the key properties of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate?
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate has a molecular weight of 378.86 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 6-chloro-2,4-dimethyl-3-oxo-1,4-benzoxazine-8-carboxylate is sourced from PubChem (CID 14719859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).