About 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine
2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine (PubChem CID 14719924) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine.
Analyze 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine?
The IUPAC name of 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine (CID 14719924) is 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine.
What is the SMILES notation for 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine?
The canonical SMILES for 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is Cc1cn2c(n1)CNCC2.
What is the InChIKey of 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine?
The InChIKey is VJISEYLRRDUZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-6-5-10-3-2-8-4-7(10)9-6/h5,8H,2-4H2,1H3.
What are the key properties of 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine?
2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine has a molecular weight of 137.19 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is sourced from PubChem (CID 14719924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).