About N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide
N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide (PubChem CID 14720027) has the molecular formula C17H33F2N3O3
and a molecular weight of 365.47 g/mol. Its IUPAC name is N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide.
Molecular Properties
| Compound Name | N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide |
| PubChem CID | 14720027 |
| Molecular Formula | C17H33F2N3O3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide |
| SMILES | CC(C)CCNC(=O)C(C)C(=O)NCC(F)(F)C(O)C(N)CC(C)C |
| InChI | InChI=1S/C17H33F2N3O3/c1-10(2)6-7-21-15(24)12(5)16(25)22-9-17(18,19)14(23)13(20)8-11(3)4/h10-14,23H,6-9,20H2,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | KNAIBCOYSNYWIX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide?
The IUPAC name of N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide (CID 14720027) is N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide.
What is the SMILES notation for N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide?
The canonical SMILES for N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide is CC(C)CCNC(=O)C(C)C(=O)NCC(F)(F)C(O)C(N)CC(C)C.
What is the InChIKey of N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide?
The InChIKey is KNAIBCOYSNYWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33F2N3O3/c1-10(2)6-7-21-15(24)12(5)16(25)22-9-17(18,19)14(23)13(20)8-11(3)4/h10-14,23H,6-9,20H2,1-5H3,(H,21,24)(H,22,25).
What are the key properties of N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide?
N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide has a molecular weight of 365.47 g/mol, XLogP of 1.27, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,2-difluoro-3-hydroxy-6-methylheptyl)-2-methyl-N'-(3-methylbutyl)propanediamide is sourced from PubChem (CID 14720027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).