C29H39F2N3O5 — CID 14720043
benzyl N-[1-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate (PubChem CID 14720043) has the molecular formula C29H39F2N3O5 and a molecular weight of 547.64 g/mol. Its IUPAC name is benzyl N-[1-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate.
| Compound Name | benzyl N-[1-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate |
|---|---|
| PubChem CID | 14720043 |
| Molecular Formula | C29H39F2N3O5 |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | benzyl N-[1-[[2-(benzylcarbamoyl)-3-methylbutanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(O)C(F)(F)CNC(=O)C(C(=O)NCc1ccccc1)C(C)C |
| InChI | InChI=1S/C29H39F2N3O5/c1-19(2)15-23(34-28(38)39-17-22-13-9-6-10-14-22)25(35)29(30,31)18-33-27(37)24(20(3)4)26(36)32-16-21-11-7-5-8-12-21/h5-14,19-20,23-25,35H,15-18H2,1-4H3,(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | QBQCJLRLSUPWQF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|