C27H35F2N3O5 — CID 14720067
benzyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate (PubChem CID 14720067) has the molecular formula C27H35F2N3O5 and a molecular weight of 519.59 g/mol. Its IUPAC name is benzyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate.
| Compound Name | benzyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate |
|---|---|
| PubChem CID | 14720067 |
| Molecular Formula | C27H35F2N3O5 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | benzyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(O)C(F)(F)CNC(=O)C(C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H35F2N3O5/c1-18(2)14-22(32-26(36)37-16-21-12-8-5-9-13-21)23(33)27(28,29)17-31-25(35)19(3)24(34)30-15-20-10-6-4-7-11-20/h4-13,18-19,22-23,33H,14-17H2,1-3H3,(H,30,34)(H,31,35)(H,32,36) |
| InChIKey | WHOFMYXKORRDOD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|