C24H37F2N3O5 — CID 14720079
tert-butyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate (PubChem CID 14720079) has the molecular formula C24H37F2N3O5 and a molecular weight of 485.57 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate |
|---|---|
| PubChem CID | 14720079 |
| Molecular Formula | C24H37F2N3O5 |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | tert-butyl N-[1-[[3-(benzylamino)-2-methyl-3-oxopropanoyl]amino]-2,2-difluoro-3-hydroxy-6-methylheptan-4-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(O)C(F)(F)CNC(=O)C(C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H37F2N3O5/c1-15(2)12-18(29-22(33)34-23(4,5)6)19(30)24(25,26)14-28-21(32)16(3)20(31)27-13-17-10-8-7-9-11-17/h7-11,15-16,18-19,30H,12-14H2,1-6H3,(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | ZPLCKGXRXLWOBU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|