About benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate
benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate (PubChem CID 14720097) has the molecular formula C21H24F2N2O4
and a molecular weight of 406.43 g/mol. Its IUPAC name is benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate.
Molecular Properties
| Compound Name | benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate |
| PubChem CID | 14720097 |
| Molecular Formula | C21H24F2N2O4 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate |
| SMILES | CC(=O)NCC(F)(F)C(O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24F2N2O4/c1-15(26)24-14-21(22,23)19(27)18(12-16-8-4-2-5-9-16)25-20(28)29-13-17-10-6-3-7-11-17/h2-11,18-19,27H,12-14H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | IILPTVRQRJGOOI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate?
The IUPAC name of benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate (CID 14720097) is benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate.
What is the SMILES notation for benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate?
The canonical SMILES for benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate is CC(=O)NCC(F)(F)C(O)C(Cc1ccccc1)NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate?
The InChIKey is IILPTVRQRJGOOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2N2O4/c1-15(26)24-14-21(22,23)19(27)18(12-16-8-4-2-5-9-16)25-20(28)29-13-17-10-6-3-7-11-17/h2-11,18-19,27H,12-14H2,1H3,(H,24,26)(H,25,28).
What are the key properties of benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate?
benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate has a molecular weight of 406.43 g/mol, XLogP of 2.66, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(5-acetamido-4,4-difluoro-3-hydroxy-1-phenylpentan-2-yl)carbamate is sourced from PubChem (CID 14720097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).