About N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide
N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide (PubChem CID 14720108) has the molecular formula C9H18F2N2O2
and a molecular weight of 224.25 g/mol. Its IUPAC name is N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide.
Molecular Properties
| Compound Name | N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide |
| PubChem CID | 14720108 |
| Molecular Formula | C9H18F2N2O2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide |
| SMILES | CC(=O)NCC(F)(F)C(O)C(N)C(C)C |
| InChI | InChI=1S/C9H18F2N2O2/c1-5(2)7(12)8(15)9(10,11)4-13-6(3)14/h5,7-8,15H,4,12H2,1-3H3,(H,13,14) |
| InChIKey | JGIIJGGPVZWIOE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide?
The IUPAC name of N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide (CID 14720108) is N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide.
What is the SMILES notation for N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide?
The canonical SMILES for N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide is CC(=O)NCC(F)(F)C(O)C(N)C(C)C.
What is the InChIKey of N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide?
The InChIKey is JGIIJGGPVZWIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2O2/c1-5(2)7(12)8(15)9(10,11)4-13-6(3)14/h5,7-8,15H,4,12H2,1-3H3,(H,13,14).
What are the key properties of N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide?
N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide has a molecular weight of 224.25 g/mol, XLogP of 0.10, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,2-difluoro-3-hydroxy-5-methylhexyl)acetamide is sourced from PubChem (CID 14720108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).