C19H24N6 — CID 147204907
7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,2-dimethyl-3,4-dihydro-1H-1,8-naphthyridine (PubChem CID 147204907) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,2-dimethyl-3,4-dihydro-1H-1,8-naphthyridine.
| Compound Name | 7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,2-dimethyl-3,4-dihydro-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 147204907 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 7-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-2,2-dimethyl-3,4-dihydro-1H-1,8-naphthyridine |
| SMILES | Cc1ncc(C)n2nc(CCc3ccc4c(n3)NC(C)(C)CC4)nc12 |
| InChI | InChI=1S/C19H24N6/c1-12-11-20-13(2)18-22-16(24-25(12)18)8-7-15-6-5-14-9-10-19(3,4)23-17(14)21-15/h5-6,11H,7-10H2,1-4H3,(H,21,23) |
| InChIKey | CEBNGQSDACTMTH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |