C14H10O3S — CID 147206172
3-oxa-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene 11,11-dioxide (PubChem CID 147206172) has the molecular formula C14H10O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-oxa-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene 11,11-dioxide.
| Compound Name | 3-oxa-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene 11,11-dioxide |
|---|---|
| PubChem CID | 147206172 |
| Molecular Formula | C14H10O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-oxa-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene 11,11-dioxide |
| SMILES | O=S1(=O)c2ccccc2C2OC2c2ccccc21 |
| InChI | InChI=1S/C14H10O3S/c15-18(16)11-7-3-1-5-9(11)13-14(17-13)10-6-2-4-8-12(10)18/h1-8,13-14H |
| InChIKey | CEHWKMXBPPHYKH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|