C24H18N2O3 — CID 147206876
4-(4-methoxyphenyl)-6-quinolin-3-yl-1,4-benzoxazin-3-one (PubChem CID 147206876) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-quinolin-3-yl-1,4-benzoxazin-3-one.
| Compound Name | 4-(4-methoxyphenyl)-6-quinolin-3-yl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 147206876 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-quinolin-3-yl-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(N2C(=O)COc3ccc(-c4cnc5ccccc5c4)cc32)cc1 |
| InChI | InChI=1S/C24H18N2O3/c1-28-20-9-7-19(8-10-20)26-22-13-16(6-11-23(22)29-15-24(26)27)18-12-17-4-2-3-5-21(17)25-14-18/h2-14H,15H2,1H3 |
| InChIKey | CELFRCHPJSSCQD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |