About 2-azidopropanoic acid
2-azidopropanoic acid (PubChem CID 14720889) has the molecular formula C3H5N3O2
and a molecular weight of 115.09 g/mol. Its IUPAC name is 2-azidopropanoic acid.
Molecular Properties
| Compound Name | 2-azidopropanoic acid |
| PubChem CID | 14720889 |
| Molecular Formula | C3H5N3O2 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 2-azidopropanoic acid |
| SMILES | CC(N=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C3H5N3O2/c1-2(3(7)8)5-6-4/h2H,1H3,(H,7,8) |
| InChIKey | XVNBLPHVIQXLMS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azidopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidopropanoic acid?
The IUPAC name of 2-azidopropanoic acid (CID 14720889) is 2-azidopropanoic acid.
What is the SMILES notation for 2-azidopropanoic acid?
The canonical SMILES for 2-azidopropanoic acid is CC(N=[N+]=[N-])C(=O)O.
What is the InChIKey of 2-azidopropanoic acid?
The InChIKey is XVNBLPHVIQXLMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O2/c1-2(3(7)8)5-6-4/h2H,1H3,(H,7,8).
What are the key properties of 2-azidopropanoic acid?
2-azidopropanoic acid has a molecular weight of 115.09 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidopropanoic acid is sourced from PubChem (CID 14720889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).