C21H30INO2 — CID 147211487
methyl 3-(4-iodophenyl)-8-(4-methylpentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 147211487) has the molecular formula C21H30INO2 and a molecular weight of 455.38 g/mol. Its IUPAC name is methyl 3-(4-iodophenyl)-8-(4-methylpentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-(4-iodophenyl)-8-(4-methylpentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 147211487 |
| Molecular Formula | C21H30INO2 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | methyl 3-(4-iodophenyl)-8-(4-methylpentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccc(I)cc2)CC2CCC1N2CCCC(C)C |
| InChI | InChI=1S/C21H30INO2/c1-14(2)5-4-12-23-17-10-11-19(23)20(21(24)25-3)18(13-17)15-6-8-16(22)9-7-15/h6-9,14,17-20H,4-5,10-13H2,1-3H3 |
| InChIKey | CFGXHFNVQRFIBS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|