About 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one
2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one (PubChem CID 14721566) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one |
| PubChem CID | 14721566 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one |
| SMILES | O=C1CCCc2sc(CO)cc21 |
| InChI | InChI=1S/C9H10O2S/c10-5-6-4-7-8(11)2-1-3-9(7)12-6/h4,10H,1-3,5H2 |
| InChIKey | MZYRNVNLEZEYBZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The IUPAC name of 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one (CID 14721566) is 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one.
What is the SMILES notation for 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The canonical SMILES for 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one is O=C1CCCc2sc(CO)cc21.
What is the InChIKey of 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The InChIKey is MZYRNVNLEZEYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c10-5-6-4-7-8(11)2-1-3-9(7)12-6/h4,10H,1-3,5H2.
What are the key properties of 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one has a molecular weight of 182.24 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-6,7-dihydro-5H-1-benzothiophen-4-one is sourced from PubChem (CID 14721566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).