C26H25FN4O4S — CID 147215809
piperidin-4-yl 4-[3-fluoro-4-[2-(1-methylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-3-oxobutanoate (PubChem CID 147215809) has the molecular formula C26H25FN4O4S and a molecular weight of 508.58 g/mol. Its IUPAC name is piperidin-4-yl 4-[3-fluoro-4-[2-(1-methylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-3-oxobutanoate.
| Compound Name | piperidin-4-yl 4-[3-fluoro-4-[2-(1-methylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 147215809 |
| Molecular Formula | C26H25FN4O4S |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | piperidin-4-yl 4-[3-fluoro-4-[2-(1-methylimidazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-3-oxobutanoate |
| SMILES | Cn1ccnc1-c1cc2nccc(Oc3ccc(CC(=O)CC(=O)OC4CCNCC4)cc3F)c2s1 |
| InChI | InChI=1S/C26H25FN4O4S/c1-31-11-10-30-26(31)23-15-20-25(36-23)22(6-9-29-20)35-21-3-2-16(13-19(21)27)12-17(32)14-24(33)34-18-4-7-28-8-5-18/h2-3,6,9-11,13,15,18,28H,4-5,7-8,12,14H2,1H3 |
| InChIKey | CGBZNRPQALGLCZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|