C15H10F7N3OS2 — CID 14721623
2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfanyl]-1H-thieno[3,4-d]imidazole (PubChem CID 14721623) has the molecular formula C15H10F7N3OS2 and a molecular weight of 445.39 g/mol. Its IUPAC name is 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfanyl]-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfanyl]-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 14721623 |
| Molecular Formula | C15H10F7N3OS2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfanyl]-1H-thieno[3,4-d]imidazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)COc1ccnc(CSc2nc3cscc3[nH]2)c1 |
| InChI | InChI=1S/C15H10F7N3OS2/c16-13(17,14(18,19)15(20,21)22)7-26-9-1-2-23-8(3-9)4-28-12-24-10-5-27-6-11(10)25-12/h1-3,5-6H,4,7H2,(H,24,25) |
| InChIKey | GSMGHNQNMSRSHK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|