C17H14F7N3O2S2 — CID 14721626
2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfinyl]-4,6-dimethyl-1H-thieno[3,4-d]imidazole (PubChem CID 14721626) has the molecular formula C17H14F7N3O2S2 and a molecular weight of 489.44 g/mol. Its IUPAC name is 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfinyl]-4,6-dimethyl-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfinyl]-4,6-dimethyl-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 14721626 |
| Molecular Formula | C17H14F7N3O2S2 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfinyl]-4,6-dimethyl-1H-thieno[3,4-d]imidazole |
| SMILES | Cc1sc(C)c2[nH]c(S(=O)Cc3cc(OCC(F)(F)C(F)(F)C(F)(F)F)ccn3)nc12 |
| InChI | InChI=1S/C17H14F7N3O2S2/c1-8-12-13(9(2)30-8)27-14(26-12)31(28)6-10-5-11(3-4-25-10)29-7-15(18,19)16(20,21)17(22,23)24/h3-5H,6-7H2,1-2H3,(H,26,27) |
| InChIKey | VBXAKCZIQVITSV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|