C16H9F7N2O3 — CID 14721692
2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzamide (PubChem CID 14721692) has the molecular formula C16H9F7N2O3 and a molecular weight of 410.25 g/mol. Its IUPAC name is 2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 14721692 |
| Molecular Formula | C16H9F7N2O3 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2,6-difluoro-N-[[2-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(OC(F)(F)C(F)F)cc1F |
| InChI | InChI=1S/C16H9F7N2O3/c17-8-2-1-3-9(18)12(8)13(26)25-15(27)24-11-5-4-7(6-10(11)19)28-16(22,23)14(20)21/h1-6,14H,(H2,24,25,26,27) |
| InChIKey | FIOZHYUMQMOMDK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|